C11H12N2O3 — CID 89169267
N-[(2S)-1,5-dioxopentan-2-yl]pyridine-3-carboxamide (PubChem CID 89169267) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is N-[(2S)-1,5-dioxopentan-2-yl]pyridine-3-carboxamide.
| Compound Name | N-[(2S)-1,5-dioxopentan-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 89169267 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | N-[(2S)-1,5-dioxopentan-2-yl]pyridine-3-carboxamide |
| SMILES | O=CCC[C@@H](C=O)NC(=O)c1cccnc1 |
| InChI | InChI=1S/C11H12N2O3/c14-6-2-4-10(8-15)13-11(16)9-3-1-5-12-7-9/h1,3,5-8,10H,2,4H2,(H,13,16)/t10-/m0/s1 |
| InChIKey | UPHUHSLDOFLDNH-JTQLQIEISA-N |
| XLogP | 0.36 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|