C11H14ClN3O2 — CID 174451033
N-[(2R)-5-amino-1-oxopentan-2-yl]-2-chloropyridine-3-carboxamide (PubChem CID 174451033) has the molecular formula C11H14ClN3O2 and a molecular weight of 255.71 g/mol. Its IUPAC name is N-[(2R)-5-amino-1-oxopentan-2-yl]-2-chloropyridine-3-carboxamide.
| Compound Name | N-[(2R)-5-amino-1-oxopentan-2-yl]-2-chloropyridine-3-carboxamide |
|---|---|
| PubChem CID | 174451033 |
| Molecular Formula | C11H14ClN3O2 |
| Molecular Weight | 255.71 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | N-[(2R)-5-amino-1-oxopentan-2-yl]-2-chloropyridine-3-carboxamide |
| SMILES | NCCC[C@H](C=O)NC(=O)c1cccnc1Cl |
| InChI | InChI=1S/C11H14ClN3O2/c12-10-9(4-2-6-14-10)11(17)15-8(7-16)3-1-5-13/h2,4,6-8H,1,3,5,13H2,(H,15,17)/t8-/m1/s1 |
| InChIKey | UQSQQYDOQRJCGD-MRVPVSSYSA-N |
| XLogP | 0.77 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.71 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|