C30H26N2O6S — CID 159165847
(E)-but-2-enedioic acid;N-[(2S)-1-oxo-3-phenylpropan-2-yl]-4-(quinolin-2-ylsulfanylmethyl)benzamide (PubChem CID 159165847) has the molecular formula C30H26N2O6S and a molecular weight of 542.61 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;N-[(2S)-1-oxo-3-phenylpropan-2-yl]-4-(quinolin-2-ylsulfanylmethyl)benzamide.
| Compound Name | (E)-but-2-enedioic acid;N-[(2S)-1-oxo-3-phenylpropan-2-yl]-4-(quinolin-2-ylsulfanylmethyl)benzamide |
|---|---|
| PubChem CID | 159165847 |
| Molecular Formula | C30H26N2O6S |
| Molecular Weight | 542.61 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | (E)-but-2-enedioic acid;N-[(2S)-1-oxo-3-phenylpropan-2-yl]-4-(quinolin-2-ylsulfanylmethyl)benzamide |
| SMILES | O=C(O)/C=C/C(=O)O.O=C[C@H](Cc1ccccc1)NC(=O)c1ccc(CSc2ccc3ccccc3n2)cc1 |
| InChI | InChI=1S/C26H22N2O2S.C4H4O4/c29-17-23(16-19-6-2-1-3-7-19)27-26(30)22-12-10-20(11-13-22)18-31-25-15-14-21-8-4-5-9-24(21)28-25;5-3(6)1-2-4(7)8/h1-15,17,23H,16,18H2,(H,27,30);1-2H,(H,5,6)(H,7,8)/b;2-1+/t23-;/m0./s1 |
| InChIKey | RAKPWBVJUBDKRG-LASJEQTRSA-N |
| XLogP | 4.78 |
| TPSA | 133.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.61 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|