C17H18Br3N2O+ — CID 4225844
benzyl-[2,2,2-tribromo-1-[(4-methylbenzoyl)amino]ethyl]azanium (PubChem CID 4225844) has the molecular formula C17H18Br3N2O+ and a molecular weight of 506.06 g/mol. Its IUPAC name is benzyl-[2,2,2-tribromo-1-[(4-methylbenzoyl)amino]ethyl]azanium.
| Compound Name | benzyl-[2,2,2-tribromo-1-[(4-methylbenzoyl)amino]ethyl]azanium |
|---|---|
| PubChem CID | 4225844 |
| Molecular Formula | C17H18Br3N2O+ |
| Molecular Weight | 506.06 g/mol |
| Exact Mass | 502.90 |
| IUPAC Name | benzyl-[2,2,2-tribromo-1-[(4-methylbenzoyl)amino]ethyl]azanium |
| SMILES | Cc1ccc(C(=O)NC([NH2+]Cc2ccccc2)C(Br)(Br)Br)cc1 |
| InChI | InChI=1S/C17H17Br3N2O/c1-12-7-9-14(10-8-12)15(23)22-16(17(18,19)20)21-11-13-5-3-2-4-6-13/h2-10,16,21H,11H2,1H3,(H,22,23)/p+1 |
| InChIKey | RQWHDONRTVQVBK-UHFFFAOYSA-O |
| XLogP | 3.65 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.06 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|