C22H19Cl2INOP — CID 45049454
(1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium iodide (PubChem CID 45049454) has the molecular formula C22H19Cl2INOP and a molecular weight of 542.18 g/mol. Its IUPAC name is (1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium iodide.
| Compound Name | (1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium iodide |
|---|---|
| PubChem CID | 45049454 |
| Molecular Formula | C22H19Cl2INOP |
| Molecular Weight | 542.18 g/mol |
| Exact Mass | 540.96 |
| IUPAC Name | (1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium iodide |
| SMILES | CC(=O)NC(=C(Cl)Cl)[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[I-] |
| InChI | InChI=1S/C22H18Cl2NOP.HI/c1-17(26)25-22(21(23)24)27(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20;/h2-16H,1H3;1H |
| InChIKey | PJZRSNUCJQONMR-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.18 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|