C22H20Cl3NO2P+ — CID 126959400
[2,2-dichloro-1-(methoxycarbonylamino)ethenyl]-triphenylphosphanium;hydrochloride (PubChem CID 126959400) has the molecular formula C22H20Cl3NO2P+ and a molecular weight of 467.74 g/mol. Its IUPAC name is [2,2-dichloro-1-(methoxycarbonylamino)ethenyl]-triphenylphosphanium;hydrochloride.
| Compound Name | [2,2-dichloro-1-(methoxycarbonylamino)ethenyl]-triphenylphosphanium;hydrochloride |
|---|---|
| PubChem CID | 126959400 |
| Molecular Formula | C22H20Cl3NO2P+ |
| Molecular Weight | 467.74 g/mol |
| Exact Mass | 466.03 |
| IUPAC Name | [2,2-dichloro-1-(methoxycarbonylamino)ethenyl]-triphenylphosphanium;hydrochloride |
| SMILES | COC(=O)NC(=C(Cl)Cl)[P+](c1ccccc1)(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C22H18Cl2NO2P.ClH/c1-27-22(26)25-21(20(23)24)28(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19;/h2-16H,1H3;1H/p+1 |
| InChIKey | MTLYAADGKRMGAJ-UHFFFAOYSA-O |
| XLogP | 5.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.74 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|