About methyl carbonobromidate;methyl(triphenyl)phosphanium
methyl carbonobromidate;methyl(triphenyl)phosphanium (PubChem CID 146562792) has the molecular formula C21H21BrO2P+
and a molecular weight of 416.28 g/mol. Its IUPAC name is methyl carbonobromidate;methyl(triphenyl)phosphanium.
Molecular Properties
| Compound Name | methyl carbonobromidate;methyl(triphenyl)phosphanium |
| PubChem CID | 146562792 |
| Molecular Formula | C21H21BrO2P+ |
| Molecular Weight | 416.28 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | methyl carbonobromidate;methyl(triphenyl)phosphanium |
| SMILES | COC(=O)Br.C[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H18P.C2H3BrO2/c1-20(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19;1-5-2(3)4/h2-16H,1H3;1H3/q+1; |
| InChIKey | MRKZLTPPTOMTAQ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.28 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methyl carbonobromidate;methyl(triphenyl)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl carbonobromidate;methyl(triphenyl)phosphanium?
The IUPAC name of methyl carbonobromidate;methyl(triphenyl)phosphanium (CID 146562792) is methyl carbonobromidate;methyl(triphenyl)phosphanium.
What is the SMILES notation for methyl carbonobromidate;methyl(triphenyl)phosphanium?
The canonical SMILES for methyl carbonobromidate;methyl(triphenyl)phosphanium is COC(=O)Br.C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of methyl carbonobromidate;methyl(triphenyl)phosphanium?
The InChIKey is MRKZLTPPTOMTAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18P.C2H3BrO2/c1-20(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19;1-5-2(3)4/h2-16H,1H3;1H3/q+1;.
What are the key properties of methyl carbonobromidate;methyl(triphenyl)phosphanium?
methyl carbonobromidate;methyl(triphenyl)phosphanium has a molecular weight of 416.28 g/mol, XLogP of 4.76, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl carbonobromidate;methyl(triphenyl)phosphanium is sourced from PubChem (CID 146562792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).