About methyl(triphenyl)phosphanium;tetrafluoroalumanuide
methyl(triphenyl)phosphanium;tetrafluoroalumanuide (PubChem CID 21264908) has the molecular formula C19H18AlF4P
and a molecular weight of 380.30 g/mol. Its IUPAC name is methyl(triphenyl)phosphanium;tetrafluoroalumanuide.
Molecular Properties
| Compound Name | methyl(triphenyl)phosphanium;tetrafluoroalumanuide |
| PubChem CID | 21264908 |
| Molecular Formula | C19H18AlF4P |
| Molecular Weight | 380.30 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | methyl(triphenyl)phosphanium;tetrafluoroalumanuide |
| SMILES | C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.F[Al-](F)(F)F |
| InChI | InChI=1S/C19H18P.Al.4FH/c1-20(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19;;;;;/h2-16H,1H3;;4*1H/q+1;+3;;;;/p-4 |
| InChIKey | CDOCBKBSNFGSHJ-UHFFFAOYSA-J |
| XLogP | 4.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.30 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methyl(triphenyl)phosphanium;tetrafluoroalumanuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl(triphenyl)phosphanium;tetrafluoroalumanuide?
The IUPAC name of methyl(triphenyl)phosphanium;tetrafluoroalumanuide (CID 21264908) is methyl(triphenyl)phosphanium;tetrafluoroalumanuide.
What is the SMILES notation for methyl(triphenyl)phosphanium;tetrafluoroalumanuide?
The canonical SMILES for methyl(triphenyl)phosphanium;tetrafluoroalumanuide is C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.F[Al-](F)(F)F.
What is the InChIKey of methyl(triphenyl)phosphanium;tetrafluoroalumanuide?
The InChIKey is CDOCBKBSNFGSHJ-UHFFFAOYSA-J. The full InChI is InChI=1S/C19H18P.Al.4FH/c1-20(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19;;;;;/h2-16H,1H3;;4*1H/q+1;+3;;;;/p-4.
What are the key properties of methyl(triphenyl)phosphanium;tetrafluoroalumanuide?
methyl(triphenyl)phosphanium;tetrafluoroalumanuide has a molecular weight of 380.30 g/mol, XLogP of 4.91, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methyl(triphenyl)phosphanium;tetrafluoroalumanuide is sourced from PubChem (CID 21264908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).