About chloro(diphenyl)stibane;methyl(triphenyl)phosphanium
chloro(diphenyl)stibane;methyl(triphenyl)phosphanium (PubChem CID 157067875) has the molecular formula C31H28ClPSb+
and a molecular weight of 588.75 g/mol. Its IUPAC name is chloro(diphenyl)stibane;methyl(triphenyl)phosphanium.
Molecular Properties
| Compound Name | chloro(diphenyl)stibane;methyl(triphenyl)phosphanium |
| PubChem CID | 157067875 |
| Molecular Formula | C31H28ClPSb+ |
| Molecular Weight | 588.75 g/mol |
| Exact Mass | 587.06 |
| IUPAC Name | chloro(diphenyl)stibane;methyl(triphenyl)phosphanium |
| SMILES | C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.Cl[Sb](c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H18P.2C6H5.ClH.Sb/c1-20(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19;2*1-2-4-6-5-3-1;;/h2-16H,1H3;2*1-5H;1H;/q+1;;;;+1/p-1 |
| InChIKey | VKYNDXRSONDPNK-UHFFFAOYSA-M |
| XLogP | 5.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 588.75 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze chloro(diphenyl)stibane;methyl(triphenyl)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro(diphenyl)stibane;methyl(triphenyl)phosphanium?
The IUPAC name of chloro(diphenyl)stibane;methyl(triphenyl)phosphanium (CID 157067875) is chloro(diphenyl)stibane;methyl(triphenyl)phosphanium.
What is the SMILES notation for chloro(diphenyl)stibane;methyl(triphenyl)phosphanium?
The canonical SMILES for chloro(diphenyl)stibane;methyl(triphenyl)phosphanium is C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.Cl[Sb](c1ccccc1)c1ccccc1.
What is the InChIKey of chloro(diphenyl)stibane;methyl(triphenyl)phosphanium?
The InChIKey is VKYNDXRSONDPNK-UHFFFAOYSA-M. The full InChI is InChI=1S/C19H18P.2C6H5.ClH.Sb/c1-20(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19;2*1-2-4-6-5-3-1;;/h2-16H,1H3;2*1-5H;1H;/q+1;;;;+1/p-1.
What are the key properties of chloro(diphenyl)stibane;methyl(triphenyl)phosphanium?
chloro(diphenyl)stibane;methyl(triphenyl)phosphanium has a molecular weight of 588.75 g/mol, XLogP of 5.64, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloro(diphenyl)stibane;methyl(triphenyl)phosphanium is sourced from PubChem (CID 157067875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).