About CID 139150104
CID 139150104 (PubChem CID 139150104) has the molecular formula C37H18Cl12O6P2
and a molecular weight of 1045.93 g/mol.
Molecular Properties
| Compound Name | CID 139150104 |
| PubChem CID | 139150104 |
| Molecular Formula | C37H18Cl12O6P2 |
| Molecular Weight | 1045.93 g/mol |
| Exact Mass | 1039.68 |
| IUPAC Name | — |
| SMILES | C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.Clc1c(Cl)c(Cl)c2c(c1Cl)O[P-]13(O2)(Oc2c(Cl)c(Cl)c(Cl)c(Cl)c2O1)Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1O3 |
| InChI | InChI=1S/C19H18P.C18Cl12O6P/c1-20(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19;19-1-2(20)8(26)14-13(7(1)25)31-37(32-14,33-15-9(27)3(21)4(22)10(28)16(15)34-37)35-17-11(29)5(23)6(24)12(30)18(17)36-37/h2-16H,1H3;/q+1;-1 |
| InChIKey | BOZPJQDUTBMIIC-UHFFFAOYSA-N |
| XLogP | 16.43 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 57 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1045.93 |
| LogP ≤ 5 | 16.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 139150104 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139150104?
The IUPAC name of CID 139150104 (CID 139150104) is not available.
What is the SMILES notation for CID 139150104?
The canonical SMILES for CID 139150104 is C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.Clc1c(Cl)c(Cl)c2c(c1Cl)O[P-]13(O2)(Oc2c(Cl)c(Cl)c(Cl)c(Cl)c2O1)Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1O3.
What is the InChIKey of CID 139150104?
The InChIKey is BOZPJQDUTBMIIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18P.C18Cl12O6P/c1-20(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19;19-1-2(20)8(26)14-13(7(1)25)31-37(32-14,33-15-9(27)3(21)4(22)10(28)16(15)34-37)35-17-11(29)5(23)6(24)12(30)18(17)36-37/h2-16H,1H3;/q+1;-1.
What are the key properties of CID 139150104?
CID 139150104 has a molecular weight of 1045.93 g/mol, XLogP of 16.43, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139150104 is sourced from PubChem (CID 139150104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).