C14H19O3P — CID 25215352
ethoxy-(4-methyl-1-phenylpenta-2,3-dien-2-yl)phosphinic acid (PubChem CID 25215352) has the molecular formula C14H19O3P and a molecular weight of 266.28 g/mol. Its IUPAC name is ethoxy-(4-methyl-1-phenylpenta-2,3-dien-2-yl)phosphinic acid.
| Compound Name | ethoxy-(4-methyl-1-phenylpenta-2,3-dien-2-yl)phosphinic acid |
|---|---|
| PubChem CID | 25215352 |
| Molecular Formula | C14H19O3P |
| Molecular Weight | 266.28 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | ethoxy-(4-methyl-1-phenylpenta-2,3-dien-2-yl)phosphinic acid |
| SMILES | CCOP(=O)(O)C(=C=C(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C14H19O3P/c1-4-17-18(15,16)14(10-12(2)3)11-13-8-6-5-7-9-13/h5-9H,4,11H2,1-3H3,(H,15,16) |
| InChIKey | YAMGHFKUXJDGEM-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.28 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|