C14H20Cl4NO6PS2 — CID 11376071
4-chloro-N-[2,2,2-trichloro-1-diethoxyphosphoryl-1-(2-hydroxyethylsulfanyl)ethyl]benzenesulfonamide (PubChem CID 11376071) has the molecular formula C14H20Cl4NO6PS2 and a molecular weight of 535.24 g/mol. Its IUPAC name is 4-chloro-N-[2,2,2-trichloro-1-diethoxyphosphoryl-1-(2-hydroxyethylsulfanyl)ethyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[2,2,2-trichloro-1-diethoxyphosphoryl-1-(2-hydroxyethylsulfanyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 11376071 |
| Molecular Formula | C14H20Cl4NO6PS2 |
| Molecular Weight | 535.24 g/mol |
| Exact Mass | 532.92 |
| IUPAC Name | 4-chloro-N-[2,2,2-trichloro-1-diethoxyphosphoryl-1-(2-hydroxyethylsulfanyl)ethyl]benzenesulfonamide |
| SMILES | CCOP(=O)(OCC)C(NS(=O)(=O)c1ccc(Cl)cc1)(SCCO)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H20Cl4NO6PS2/c1-3-24-26(21,25-4-2)14(13(16,17)18,27-10-9-20)19-28(22,23)12-7-5-11(15)6-8-12/h5-8,19-20H,3-4,9-10H2,1-2H3 |
| InChIKey | XPRQJPHDFKMEJA-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.24 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|