C15H25NO2S — CID 86230028
4-methyl-N-(2-methylheptan-2-yl)benzenesulfonamide (PubChem CID 86230028) has the molecular formula C15H25NO2S and a molecular weight of 283.44 g/mol. Its IUPAC name is 4-methyl-N-(2-methylheptan-2-yl)benzenesulfonamide.
| Compound Name | 4-methyl-N-(2-methylheptan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 86230028 |
| Molecular Formula | C15H25NO2S |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 4-methyl-N-(2-methylheptan-2-yl)benzenesulfonamide |
| SMILES | CCCCCC(C)(C)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H25NO2S/c1-5-6-7-12-15(3,4)16-19(17,18)14-10-8-13(2)9-11-14/h8-11,16H,5-7,12H2,1-4H3 |
| InChIKey | SKMGBCSRINFXQA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|