C14H21NO3S — CID 49460708
4-acetyl-N-(2-methylpentan-2-yl)benzenesulfonamide (PubChem CID 49460708) has the molecular formula C14H21NO3S and a molecular weight of 283.39 g/mol. Its IUPAC name is 4-acetyl-N-(2-methylpentan-2-yl)benzenesulfonamide.
| Compound Name | 4-acetyl-N-(2-methylpentan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 49460708 |
| Molecular Formula | C14H21NO3S |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 4-acetyl-N-(2-methylpentan-2-yl)benzenesulfonamide |
| SMILES | CCCC(C)(C)NS(=O)(=O)c1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C14H21NO3S/c1-5-10-14(3,4)15-19(17,18)13-8-6-12(7-9-13)11(2)16/h6-9,15H,5,10H2,1-4H3 |
| InChIKey | RBRFOMWBNROLSU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |