C13H19NO4S — CID 115606746
4-acetyl-N-(1-methoxy-2-methylpropan-2-yl)benzenesulfonamide (PubChem CID 115606746) has the molecular formula C13H19NO4S and a molecular weight of 285.37 g/mol. Its IUPAC name is 4-acetyl-N-(1-methoxy-2-methylpropan-2-yl)benzenesulfonamide.
| Compound Name | 4-acetyl-N-(1-methoxy-2-methylpropan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 115606746 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 4-acetyl-N-(1-methoxy-2-methylpropan-2-yl)benzenesulfonamide |
| SMILES | COCC(C)(C)NS(=O)(=O)c1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C13H19NO4S/c1-10(15)11-5-7-12(8-6-11)19(16,17)14-13(2,3)9-18-4/h5-8,14H,9H2,1-4H3 |
| InChIKey | FLWJNYMGFYVYGI-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |