C14H16F4N2O4 — CID 3791479
ethyl 2-ethoxy-3,3,3-trifluoro-2-[(3-fluorophenyl)carbamoylamino]propanoate (PubChem CID 3791479) has the molecular formula C14H16F4N2O4 and a molecular weight of 352.28 g/mol. Its IUPAC name is ethyl 2-ethoxy-3,3,3-trifluoro-2-[(3-fluorophenyl)carbamoylamino]propanoate.
| Compound Name | ethyl 2-ethoxy-3,3,3-trifluoro-2-[(3-fluorophenyl)carbamoylamino]propanoate |
|---|---|
| PubChem CID | 3791479 |
| Molecular Formula | C14H16F4N2O4 |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | ethyl 2-ethoxy-3,3,3-trifluoro-2-[(3-fluorophenyl)carbamoylamino]propanoate |
| SMILES | CCOC(=O)C(NC(=O)Nc1cccc(F)c1)(OCC)C(F)(F)F |
| InChI | InChI=1S/C14H16F4N2O4/c1-3-23-11(21)13(24-4-2,14(16,17)18)20-12(22)19-10-7-5-6-9(15)8-10/h5-8H,3-4H2,1-2H3,(H2,19,20,22) |
| InChIKey | PEHYGHYHFZCYNM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|