C14H19FN2O3 — CID 65265962
3-[(3-fluorophenyl)carbamoylamino]-2,2,3-trimethylbutanoic acid (PubChem CID 65265962) has the molecular formula C14H19FN2O3 and a molecular weight of 282.31 g/mol. Its IUPAC name is 3-[(3-fluorophenyl)carbamoylamino]-2,2,3-trimethylbutanoic acid.
| Compound Name | 3-[(3-fluorophenyl)carbamoylamino]-2,2,3-trimethylbutanoic acid |
|---|---|
| PubChem CID | 65265962 |
| Molecular Formula | C14H19FN2O3 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 3-[(3-fluorophenyl)carbamoylamino]-2,2,3-trimethylbutanoic acid |
| SMILES | CC(C)(NC(=O)Nc1cccc(F)c1)C(C)(C)C(=O)O |
| InChI | InChI=1S/C14H19FN2O3/c1-13(2,11(18)19)14(3,4)17-12(20)16-10-7-5-6-9(15)8-10/h5-8H,1-4H3,(H,18,19)(H2,16,17,20) |
| InChIKey | HNHWUNISNNPBSY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |