C12H11F7N2O2 — CID 2264268
ethyl N-[1,1,1,3,3,3-hexafluoro-2-(2-fluoroanilino)propan-2-yl]carbamate (PubChem CID 2264268) has the molecular formula C12H11F7N2O2 and a molecular weight of 348.22 g/mol. Its IUPAC name is ethyl N-[1,1,1,3,3,3-hexafluoro-2-(2-fluoroanilino)propan-2-yl]carbamate.
| Compound Name | ethyl N-[1,1,1,3,3,3-hexafluoro-2-(2-fluoroanilino)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 2264268 |
| Molecular Formula | C12H11F7N2O2 |
| Molecular Weight | 348.22 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | ethyl N-[1,1,1,3,3,3-hexafluoro-2-(2-fluoroanilino)propan-2-yl]carbamate |
| SMILES | CCOC(=O)NC(Nc1ccccc1F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H11F7N2O2/c1-2-23-9(22)21-10(11(14,15)16,12(17,18)19)20-8-6-4-3-5-7(8)13/h3-6,20H,2H2,1H3,(H,21,22) |
| InChIKey | FUAALAGJAVWZNP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.22 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|