C9H9F6N3O2S — CID 2264258
ethyl N-[1,1,1,3,3,3-hexafluoro-2-(1,3-thiazol-2-ylamino)propan-2-yl]carbamate (PubChem CID 2264258) has the molecular formula C9H9F6N3O2S and a molecular weight of 337.25 g/mol. Its IUPAC name is ethyl N-[1,1,1,3,3,3-hexafluoro-2-(1,3-thiazol-2-ylamino)propan-2-yl]carbamate.
| Compound Name | ethyl N-[1,1,1,3,3,3-hexafluoro-2-(1,3-thiazol-2-ylamino)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 2264258 |
| Molecular Formula | C9H9F6N3O2S |
| Molecular Weight | 337.25 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | ethyl N-[1,1,1,3,3,3-hexafluoro-2-(1,3-thiazol-2-ylamino)propan-2-yl]carbamate |
| SMILES | CCOC(=O)NC(Nc1nccs1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H9F6N3O2S/c1-2-20-6(19)18-7(8(10,11)12,9(13,14)15)17-5-16-3-4-21-5/h3-4H,2H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | GNRMFIZQARGMDG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.25 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|