C8H7F6N3OS — CID 659926
1-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-3-(1,3-thiazol-2-yl)urea (PubChem CID 659926) has the molecular formula C8H7F6N3OS and a molecular weight of 307.22 g/mol. Its IUPAC name is 1-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-3-(1,3-thiazol-2-yl)urea.
| Compound Name | 1-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-3-(1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 659926 |
| Molecular Formula | C8H7F6N3OS |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | 1-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-3-(1,3-thiazol-2-yl)urea |
| SMILES | CC(NC(=O)Nc1nccs1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H7F6N3OS/c1-6(7(9,10)11,8(12,13)14)17-4(18)16-5-15-2-3-19-5/h2-3H,1H3,(H2,15,16,17,18) |
| InChIKey | XDVSFEDQGJALFS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |