C13H11F9N2O2 — CID 2264269
ethyl N-[1,1,1,3,3,3-hexafluoro-2-[2-(trifluoromethyl)anilino]propan-2-yl]carbamate (PubChem CID 2264269) has the molecular formula C13H11F9N2O2 and a molecular weight of 398.23 g/mol. Its IUPAC name is ethyl N-[1,1,1,3,3,3-hexafluoro-2-[2-(trifluoromethyl)anilino]propan-2-yl]carbamate.
| Compound Name | ethyl N-[1,1,1,3,3,3-hexafluoro-2-[2-(trifluoromethyl)anilino]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 2264269 |
| Molecular Formula | C13H11F9N2O2 |
| Molecular Weight | 398.23 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | ethyl N-[1,1,1,3,3,3-hexafluoro-2-[2-(trifluoromethyl)anilino]propan-2-yl]carbamate |
| SMILES | CCOC(=O)NC(Nc1ccccc1C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H11F9N2O2/c1-2-26-9(25)24-11(12(17,18)19,13(20,21)22)23-8-6-4-3-5-7(8)10(14,15)16/h3-6,23H,2H2,1H3,(H,24,25) |
| InChIKey | PYGHAHPMPQIKEV-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.23 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|