C14H16F6N2O — CID 16763847
N-[1,1,1,3,3,3-hexafluoro-2-(2-methylanilino)propan-2-yl]-2-methylpropanamide (PubChem CID 16763847) has the molecular formula C14H16F6N2O and a molecular weight of 342.28 g/mol. Its IUPAC name is N-[1,1,1,3,3,3-hexafluoro-2-(2-methylanilino)propan-2-yl]-2-methylpropanamide.
| Compound Name | N-[1,1,1,3,3,3-hexafluoro-2-(2-methylanilino)propan-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 16763847 |
| Molecular Formula | C14H16F6N2O |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | N-[1,1,1,3,3,3-hexafluoro-2-(2-methylanilino)propan-2-yl]-2-methylpropanamide |
| SMILES | Cc1ccccc1NC(NC(=O)C(C)C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H16F6N2O/c1-8(2)11(23)22-12(13(15,16)17,14(18,19)20)21-10-7-5-4-6-9(10)3/h4-8,21H,1-3H3,(H,22,23) |
| InChIKey | JIDKBNITLJZLJN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|