C17H13ClF6N2O — CID 3823783
N-[2-(3-chloro-2-methylanilino)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzamide (PubChem CID 3823783) has the molecular formula C17H13ClF6N2O and a molecular weight of 410.75 g/mol. Its IUPAC name is N-[2-(3-chloro-2-methylanilino)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzamide.
| Compound Name | N-[2-(3-chloro-2-methylanilino)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzamide |
|---|---|
| PubChem CID | 3823783 |
| Molecular Formula | C17H13ClF6N2O |
| Molecular Weight | 410.75 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | N-[2-(3-chloro-2-methylanilino)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzamide |
| SMILES | Cc1c(Cl)cccc1NC(NC(=O)c1ccccc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H13ClF6N2O/c1-10-12(18)8-5-9-13(10)25-15(16(19,20)21,17(22,23)24)26-14(27)11-6-3-2-4-7-11/h2-9,25H,1H3,(H,26,27) |
| InChIKey | BROZPYQYQJSWRJ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.75 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|