C15H10ClF6N3O — CID 4242902
N-[2-[(2-chloro-3-pyridinyl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]benzamide (PubChem CID 4242902) has the molecular formula C15H10ClF6N3O and a molecular weight of 397.71 g/mol. Its IUPAC name is N-[2-[(2-chloro-3-pyridinyl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]benzamide.
| Compound Name | N-[2-[(2-chloro-3-pyridinyl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]benzamide |
|---|---|
| PubChem CID | 4242902 |
| Molecular Formula | C15H10ClF6N3O |
| Molecular Weight | 397.71 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | N-[2-[(2-chloro-3-pyridinyl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]benzamide |
| SMILES | O=C(NC(Nc1cccnc1Cl)(C(F)(F)F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C15H10ClF6N3O/c16-11-10(7-4-8-23-11)24-13(14(17,18)19,15(20,21)22)25-12(26)9-5-2-1-3-6-9/h1-8,24H,(H,25,26) |
| InChIKey | CXXDLZNKZRCFHO-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.71 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|