C16H18F6N2O — CID 2817597
N-[2-(cyclohexylamino)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzamide (PubChem CID 2817597) has the molecular formula C16H18F6N2O and a molecular weight of 368.32 g/mol. Its IUPAC name is N-[2-(cyclohexylamino)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzamide.
| Compound Name | N-[2-(cyclohexylamino)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzamide |
|---|---|
| PubChem CID | 2817597 |
| Molecular Formula | C16H18F6N2O |
| Molecular Weight | 368.32 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | N-[2-(cyclohexylamino)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzamide |
| SMILES | O=C(NC(NC1CCCCC1)(C(F)(F)F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C16H18F6N2O/c17-15(18,19)14(16(20,21)22,23-12-9-5-2-6-10-12)24-13(25)11-7-3-1-4-8-11/h1,3-4,7-8,12,23H,2,5-6,9-10H2,(H,24,25) |
| InChIKey | HZJBPJBJFMQMGW-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.32 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|