C14H10ClF6N4O+ — CID 7389759
N-[2-[(5-chloropyridin-1-ium-2-yl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]pyridine-3-carboxamide (PubChem CID 7389759) has the molecular formula C14H10ClF6N4O+ and a molecular weight of 399.70 g/mol. Its IUPAC name is N-[2-[(5-chloropyridin-1-ium-2-yl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]pyridine-3-carboxamide.
| Compound Name | N-[2-[(5-chloropyridin-1-ium-2-yl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 7389759 |
| Molecular Formula | C14H10ClF6N4O+ |
| Molecular Weight | 399.70 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | N-[2-[(5-chloropyridin-1-ium-2-yl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]pyridine-3-carboxamide |
| SMILES | O=C(NC(Nc1ccc(Cl)c[nH+]1)(C(F)(F)F)C(F)(F)F)c1cccnc1 |
| InChI | InChI=1S/C14H9ClF6N4O/c15-9-3-4-10(23-7-9)24-12(13(16,17)18,14(19,20)21)25-11(26)8-2-1-5-22-6-8/h1-7H,(H,23,24)(H,25,26)/p+1 |
| InChIKey | CZCDTOIOTFNUGV-UHFFFAOYSA-O |
| XLogP | 3.21 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.70 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|