C17H14F6N4O2 — CID 16764154
N-[2-(benzylcarbamoylamino)-1,1,1,3,3,3-hexafluoropropan-2-yl]pyridine-3-carboxamide (PubChem CID 16764154) has the molecular formula C17H14F6N4O2 and a molecular weight of 420.31 g/mol. Its IUPAC name is N-[2-(benzylcarbamoylamino)-1,1,1,3,3,3-hexafluoropropan-2-yl]pyridine-3-carboxamide.
| Compound Name | N-[2-(benzylcarbamoylamino)-1,1,1,3,3,3-hexafluoropropan-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 16764154 |
| Molecular Formula | C17H14F6N4O2 |
| Molecular Weight | 420.31 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | N-[2-(benzylcarbamoylamino)-1,1,1,3,3,3-hexafluoropropan-2-yl]pyridine-3-carboxamide |
| SMILES | O=C(NCc1ccccc1)NC(NC(=O)c1cccnc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H14F6N4O2/c18-16(19,20)15(17(21,22)23,26-13(28)12-7-4-8-24-10-12)27-14(29)25-9-11-5-2-1-3-6-11/h1-8,10H,9H2,(H,26,28)(H2,25,27,29) |
| InChIKey | PXBHZTPWQYOJLF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.31 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|