C15H12F6N4O — CID 3695721
N-[1,1,1,3,3,3-hexafluoro-2-(pyridin-3-ylmethylamino)propan-2-yl]pyridine-3-carboxamide (PubChem CID 3695721) has the molecular formula C15H12F6N4O and a molecular weight of 378.28 g/mol. Its IUPAC name is N-[1,1,1,3,3,3-hexafluoro-2-(pyridin-3-ylmethylamino)propan-2-yl]pyridine-3-carboxamide.
| Compound Name | N-[1,1,1,3,3,3-hexafluoro-2-(pyridin-3-ylmethylamino)propan-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 3695721 |
| Molecular Formula | C15H12F6N4O |
| Molecular Weight | 378.28 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | N-[1,1,1,3,3,3-hexafluoro-2-(pyridin-3-ylmethylamino)propan-2-yl]pyridine-3-carboxamide |
| SMILES | O=C(NC(NCc1cccnc1)(C(F)(F)F)C(F)(F)F)c1cccnc1 |
| InChI | InChI=1S/C15H12F6N4O/c16-14(17,18)13(15(19,20)21,24-8-10-3-1-5-22-7-10)25-12(26)11-4-2-6-23-9-11/h1-7,9,24H,8H2,(H,25,26) |
| InChIKey | QMHMQDAXTYQCSX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.28 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|