C17H13F7N2O — CID 571679
N-[2-(benzylamino)-1,1,1,3,3,3-hexafluoropropan-2-yl]-3-fluorobenzamide (PubChem CID 571679) has the molecular formula C17H13F7N2O and a molecular weight of 394.29 g/mol. Its IUPAC name is N-[2-(benzylamino)-1,1,1,3,3,3-hexafluoropropan-2-yl]-3-fluorobenzamide.
| Compound Name | N-[2-(benzylamino)-1,1,1,3,3,3-hexafluoropropan-2-yl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 571679 |
| Molecular Formula | C17H13F7N2O |
| Molecular Weight | 394.29 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | N-[2-(benzylamino)-1,1,1,3,3,3-hexafluoropropan-2-yl]-3-fluorobenzamide |
| SMILES | O=C(NC(NCc1ccccc1)(C(F)(F)F)C(F)(F)F)c1cccc(F)c1 |
| InChI | InChI=1S/C17H13F7N2O/c18-13-8-4-7-12(9-13)14(27)26-15(16(19,20)21,17(22,23)24)25-10-11-5-2-1-3-6-11/h1-9,25H,10H2,(H,26,27) |
| InChIKey | MPCYJUHSOYSYNA-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.29 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|