C17H12F6N4OS — CID 571633
N-[2-[(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]pyridine-3-carboxamide (PubChem CID 571633) has the molecular formula C17H12F6N4OS and a molecular weight of 434.37 g/mol. Its IUPAC name is N-[2-[(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]pyridine-3-carboxamide.
| Compound Name | N-[2-[(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 571633 |
| Molecular Formula | C17H12F6N4OS |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | N-[2-[(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]pyridine-3-carboxamide |
| SMILES | N#Cc1c(NC(NC(=O)c2cccnc2)(C(F)(F)F)C(F)(F)F)sc2c1CCC2 |
| InChI | InChI=1S/C17H12F6N4OS/c18-16(19,20)15(17(21,22)23,26-13(28)9-3-2-6-25-8-9)27-14-11(7-24)10-4-1-5-12(10)29-14/h2-3,6,8,27H,1,4-5H2,(H,26,28) |
| InChIKey | BVOKYJIKAGFXHY-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|