C18H14F6N4OS — CID 3887648
N-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]pyridine-3-carboxamide (PubChem CID 3887648) has the molecular formula C18H14F6N4OS and a molecular weight of 448.39 g/mol. Its IUPAC name is N-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]pyridine-3-carboxamide.
| Compound Name | N-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 3887648 |
| Molecular Formula | C18H14F6N4OS |
| Molecular Weight | 448.39 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | N-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]pyridine-3-carboxamide |
| SMILES | N#Cc1c(NC(NC(=O)c2cccnc2)(C(F)(F)F)C(F)(F)F)sc2c1CCCC2 |
| InChI | InChI=1S/C18H14F6N4OS/c19-17(20,21)16(18(22,23)24,27-14(29)10-4-3-7-26-9-10)28-15-12(8-25)11-5-1-2-6-13(11)30-15/h3-4,7,9,28H,1-2,5-6H2,(H,27,29) |
| InChIKey | WFLNORYFUBPFIA-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.39 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|