C20H19F3N4O3S — CID 4143184
ethyl 2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-3,3,3-trifluoro-2-(pyridine-4-carbonylamino)propanoate (PubChem CID 4143184) has the molecular formula C20H19F3N4O3S and a molecular weight of 452.46 g/mol. Its IUPAC name is ethyl 2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-3,3,3-trifluoro-2-(pyridine-4-carbonylamino)propanoate.
| Compound Name | ethyl 2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-3,3,3-trifluoro-2-(pyridine-4-carbonylamino)propanoate |
|---|---|
| PubChem CID | 4143184 |
| Molecular Formula | C20H19F3N4O3S |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | ethyl 2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-3,3,3-trifluoro-2-(pyridine-4-carbonylamino)propanoate |
| SMILES | CCOC(=O)C(NC(=O)c1ccncc1)(Nc1sc2c(c1C#N)CCCC2)C(F)(F)F |
| InChI | InChI=1S/C20H19F3N4O3S/c1-2-30-18(29)19(20(21,22)23,26-16(28)12-7-9-25-10-8-12)27-17-14(11-24)13-5-3-4-6-15(13)31-17/h7-10,27H,2-6H2,1H3,(H,26,28) |
| InChIKey | FLDZRJRFBWPZDG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|