C17H20ClF3N2O5S — CID 3768709
methyl 2-[[2-[(2-chloroacetyl)amino]-3-ethoxy-1,1,1-trifluoro-3-oxopropan-2-yl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 3768709) has the molecular formula C17H20ClF3N2O5S and a molecular weight of 456.87 g/mol. Its IUPAC name is methyl 2-[[2-[(2-chloroacetyl)amino]-3-ethoxy-1,1,1-trifluoro-3-oxopropan-2-yl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[(2-chloroacetyl)amino]-3-ethoxy-1,1,1-trifluoro-3-oxopropan-2-yl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 3768709 |
| Molecular Formula | C17H20ClF3N2O5S |
| Molecular Weight | 456.87 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | methyl 2-[[2-[(2-chloroacetyl)amino]-3-ethoxy-1,1,1-trifluoro-3-oxopropan-2-yl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)C(NC(=O)CCl)(Nc1sc2c(c1C(=O)OC)CCCC2)C(F)(F)F |
| InChI | InChI=1S/C17H20ClF3N2O5S/c1-3-28-15(26)16(17(19,20)21,22-11(24)8-18)23-13-12(14(25)27-2)9-6-4-5-7-10(9)29-13/h23H,3-8H2,1-2H3,(H,22,24) |
| InChIKey | ACACGTVEHDYYRD-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.87 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|