C14H15F6N3O3S — CID 621493
ethyl N-[2-[(3-carbamoyl-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]carbamate (PubChem CID 621493) has the molecular formula C14H15F6N3O3S and a molecular weight of 419.35 g/mol. Its IUPAC name is ethyl N-[2-[(3-carbamoyl-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]carbamate.
| Compound Name | ethyl N-[2-[(3-carbamoyl-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]carbamate |
|---|---|
| PubChem CID | 621493 |
| Molecular Formula | C14H15F6N3O3S |
| Molecular Weight | 419.35 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | ethyl N-[2-[(3-carbamoyl-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]carbamate |
| SMILES | CCOC(=O)NC(Nc1sc2c(c1C(N)=O)CCC2)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H15F6N3O3S/c1-2-26-11(25)23-12(13(15,16)17,14(18,19)20)22-10-8(9(21)24)6-4-3-5-7(6)27-10/h22H,2-5H2,1H3,(H2,21,24)(H,23,25) |
| InChIKey | ZDUSJUFOYSZEBA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|