C17H22F3N3O4S — CID 40573615
ethyl (2S)-2-[(3-carbamoyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-3,3,3-trifluoro-2-(propanoylamino)propanoate (PubChem CID 40573615) has the molecular formula C17H22F3N3O4S and a molecular weight of 421.44 g/mol. Its IUPAC name is ethyl (2S)-2-[(3-carbamoyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-3,3,3-trifluoro-2-(propanoylamino)propanoate.
| Compound Name | ethyl (2S)-2-[(3-carbamoyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-3,3,3-trifluoro-2-(propanoylamino)propanoate |
|---|---|
| PubChem CID | 40573615 |
| Molecular Formula | C17H22F3N3O4S |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | ethyl (2S)-2-[(3-carbamoyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-3,3,3-trifluoro-2-(propanoylamino)propanoate |
| SMILES | CCOC(=O)[C@](NC(=O)CC)(Nc1sc2c(c1C(N)=O)CCCC2)C(F)(F)F |
| InChI | InChI=1S/C17H22F3N3O4S/c1-3-11(24)22-16(17(18,19)20,15(26)27-4-2)23-14-12(13(21)25)9-7-5-6-8-10(9)28-14/h23H,3-8H2,1-2H3,(H2,21,25)(H,22,24)/t16-/m0/s1 |
| InChIKey | CGHJJXRIEKPPAI-INIZCTEOSA-N |
| XLogP | 2.49 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|