C11H14F3NO — CID 106523413
3,3,3-trifluoro-2-methyl-2-(2-methylanilino)propan-1-ol (PubChem CID 106523413) has the molecular formula C11H14F3NO and a molecular weight of 233.23 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-methyl-2-(2-methylanilino)propan-1-ol.
| Compound Name | 3,3,3-trifluoro-2-methyl-2-(2-methylanilino)propan-1-ol |
|---|---|
| PubChem CID | 106523413 |
| Molecular Formula | C11H14F3NO |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 3,3,3-trifluoro-2-methyl-2-(2-methylanilino)propan-1-ol |
| SMILES | Cc1ccccc1NC(C)(CO)C(F)(F)F |
| InChI | InChI=1S/C11H14F3NO/c1-8-5-3-4-6-9(8)15-10(2,7-16)11(12,13)14/h3-6,15-16H,7H2,1-2H3 |
| InChIKey | YLWBUACHVFVOOR-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |