C14H15F2NO5 — CID 59587668
diethyl 2-[(2,6-difluorobenzoyl)amino]propanedioate (PubChem CID 59587668) has the molecular formula C14H15F2NO5 and a molecular weight of 315.27 g/mol. Its IUPAC name is diethyl 2-[(2,6-difluorobenzoyl)amino]propanedioate.
| Compound Name | diethyl 2-[(2,6-difluorobenzoyl)amino]propanedioate |
|---|---|
| PubChem CID | 59587668 |
| Molecular Formula | C14H15F2NO5 |
| Molecular Weight | 315.27 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | diethyl 2-[(2,6-difluorobenzoyl)amino]propanedioate |
| SMILES | CCOC(=O)C(NC(=O)c1c(F)cccc1F)C(=O)OCC |
| InChI | InChI=1S/C14H15F2NO5/c1-3-21-13(19)11(14(20)22-4-2)17-12(18)10-8(15)6-5-7-9(10)16/h5-7,11H,3-4H2,1-2H3,(H,17,18) |
| InChIKey | HSVLDJKKEBIBHD-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.27 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|