C14H17ClFNO3 — CID 124854483
ethyl (2S,3R)-3-[(2-chloro-6-fluorobenzoyl)amino]-2-methylbutanoate (PubChem CID 124854483) has the molecular formula C14H17ClFNO3 and a molecular weight of 301.75 g/mol. Its IUPAC name is ethyl (2S,3R)-3-[(2-chloro-6-fluorobenzoyl)amino]-2-methylbutanoate.
| Compound Name | ethyl (2S,3R)-3-[(2-chloro-6-fluorobenzoyl)amino]-2-methylbutanoate |
|---|---|
| PubChem CID | 124854483 |
| Molecular Formula | C14H17ClFNO3 |
| Molecular Weight | 301.75 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | ethyl (2S,3R)-3-[(2-chloro-6-fluorobenzoyl)amino]-2-methylbutanoate |
| SMILES | CCOC(=O)[C@@H](C)[C@@H](C)NC(=O)c1c(F)cccc1Cl |
| InChI | InChI=1S/C14H17ClFNO3/c1-4-20-14(19)8(2)9(3)17-13(18)12-10(15)6-5-7-11(12)16/h5-9H,4H2,1-3H3,(H,17,18)/t8-,9+/m0/s1 |
| InChIKey | XKKXYRUYFAAUMM-DTWKUNHWSA-N |
| XLogP | 2.80 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.75 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |