C12H21F3N2O3 — CID 4298119
ethyl 2-(butanoylamino)-3,3,3-trifluoro-2-(propan-2-ylamino)propanoate (PubChem CID 4298119) has the molecular formula C12H21F3N2O3 and a molecular weight of 298.31 g/mol. Its IUPAC name is ethyl 2-(butanoylamino)-3,3,3-trifluoro-2-(propan-2-ylamino)propanoate.
| Compound Name | ethyl 2-(butanoylamino)-3,3,3-trifluoro-2-(propan-2-ylamino)propanoate |
|---|---|
| PubChem CID | 4298119 |
| Molecular Formula | C12H21F3N2O3 |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | ethyl 2-(butanoylamino)-3,3,3-trifluoro-2-(propan-2-ylamino)propanoate |
| SMILES | CCCC(=O)NC(NC(C)C)(C(=O)OCC)C(F)(F)F |
| InChI | InChI=1S/C12H21F3N2O3/c1-5-7-9(18)17-11(12(13,14)15,16-8(3)4)10(19)20-6-2/h8,16H,5-7H2,1-4H3,(H,17,18) |
| InChIKey | ADTFZJLWUAPPIK-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|