C16H17ClF6N2O3 — CID 537859
ethyl 2-(butanoylamino)-2-[4-chloro-2-(trifluoromethyl)anilino]-3,3,3-trifluoropropanoate (PubChem CID 537859) has the molecular formula C16H17ClF6N2O3 and a molecular weight of 434.76 g/mol. Its IUPAC name is ethyl 2-(butanoylamino)-2-[4-chloro-2-(trifluoromethyl)anilino]-3,3,3-trifluoropropanoate.
| Compound Name | ethyl 2-(butanoylamino)-2-[4-chloro-2-(trifluoromethyl)anilino]-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 537859 |
| Molecular Formula | C16H17ClF6N2O3 |
| Molecular Weight | 434.76 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | ethyl 2-(butanoylamino)-2-[4-chloro-2-(trifluoromethyl)anilino]-3,3,3-trifluoropropanoate |
| SMILES | CCCC(=O)NC(Nc1ccc(Cl)cc1C(F)(F)F)(C(=O)OCC)C(F)(F)F |
| InChI | InChI=1S/C16H17ClF6N2O3/c1-3-5-12(26)25-14(16(21,22)23,13(27)28-4-2)24-11-7-6-9(17)8-10(11)15(18,19)20/h6-8,24H,3-5H2,1-2H3,(H,25,26) |
| InChIKey | WJBRWKBDYGQBHX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.76 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|