C21H26F3N5O5S — CID 537712
ethyl 2-(butanoylamino)-2-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]anilino]-3,3,3-trifluoropropanoate (PubChem CID 537712) has the molecular formula C21H26F3N5O5S and a molecular weight of 517.53 g/mol. Its IUPAC name is ethyl 2-(butanoylamino)-2-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]anilino]-3,3,3-trifluoropropanoate.
| Compound Name | ethyl 2-(butanoylamino)-2-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]anilino]-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 537712 |
| Molecular Formula | C21H26F3N5O5S |
| Molecular Weight | 517.53 g/mol |
| Exact Mass | 517.16 |
| IUPAC Name | ethyl 2-(butanoylamino)-2-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]anilino]-3,3,3-trifluoropropanoate |
| SMILES | CCCC(=O)NC(Nc1ccc(S(=O)(=O)Nc2nc(C)cc(C)n2)cc1)(C(=O)OCC)C(F)(F)F |
| InChI | InChI=1S/C21H26F3N5O5S/c1-5-7-17(30)28-20(21(22,23)24,18(31)34-6-2)27-15-8-10-16(11-9-15)35(32,33)29-19-25-13(3)12-14(4)26-19/h8-12,27H,5-7H2,1-4H3,(H,28,30)(H,25,26,29) |
| InChIKey | QTMNUZQFEQGWIG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 139.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.53 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|