C8H8ClF3O3 — CID 10467013
ethyl 2-chloro-3,3,3-trifluoro-2-prop-2-ynoxypropanoate (PubChem CID 10467013) has the molecular formula C8H8ClF3O3 and a molecular weight of 244.60 g/mol. Its IUPAC name is ethyl 2-chloro-3,3,3-trifluoro-2-prop-2-ynoxypropanoate.
| Compound Name | ethyl 2-chloro-3,3,3-trifluoro-2-prop-2-ynoxypropanoate |
|---|---|
| PubChem CID | 10467013 |
| Molecular Formula | C8H8ClF3O3 |
| Molecular Weight | 244.60 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | ethyl 2-chloro-3,3,3-trifluoro-2-prop-2-ynoxypropanoate |
| SMILES | C#CCOC(Cl)(C(=O)OCC)C(F)(F)F |
| InChI | InChI=1S/C8H8ClF3O3/c1-3-5-15-7(9,8(10,11)12)6(13)14-4-2/h1H,4-5H2,2H3 |
| InChIKey | LABGNUQFXGKZBS-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.60 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|