C24H34O8 — CID 10972404
tetraethyl dodeca-1,11-diyne-5,5,6,6-tetracarboxylate (PubChem CID 10972404) has the molecular formula C24H34O8 and a molecular weight of 450.53 g/mol. Its IUPAC name is tetraethyl dodeca-1,11-diyne-5,5,6,6-tetracarboxylate.
| Compound Name | tetraethyl dodeca-1,11-diyne-5,5,6,6-tetracarboxylate |
|---|---|
| PubChem CID | 10972404 |
| Molecular Formula | C24H34O8 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | tetraethyl dodeca-1,11-diyne-5,5,6,6-tetracarboxylate |
| SMILES | C#CCCCC(C(=O)OCC)(C(=O)OCC)C(CCCC#C)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C24H34O8/c1-7-13-15-17-23(19(25)29-9-3,20(26)30-10-4)24(18-16-14-8-2,21(27)31-11-5)22(28)32-12-6/h1-2H,9-18H2,3-6H3 |
| InChIKey | WTOBBVYYKJVQRM-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|