C14H8Cl14O8S2 — CID 10941912
bis(2,2,2-trichloroethyl) 2-chloro-2-[[2-chloro-1,3-dioxo-1,3-bis(2,2,2-trichloroethoxy)propan-2-yl]disulfanyl]propanedioate (PubChem CID 10941912) has the molecular formula C14H8Cl14O8S2 and a molecular weight of 864.69 g/mol. Its IUPAC name is bis(2,2,2-trichloroethyl) 2-chloro-2-[[2-chloro-1,3-dioxo-1,3-bis(2,2,2-trichloroethoxy)propan-2-yl]disulfanyl]propanedioate.
| Compound Name | bis(2,2,2-trichloroethyl) 2-chloro-2-[[2-chloro-1,3-dioxo-1,3-bis(2,2,2-trichloroethoxy)propan-2-yl]disulfanyl]propanedioate |
|---|---|
| PubChem CID | 10941912 |
| Molecular Formula | C14H8Cl14O8S2 |
| Molecular Weight | 864.69 g/mol |
| Exact Mass | 857.53 |
| IUPAC Name | bis(2,2,2-trichloroethyl) 2-chloro-2-[[2-chloro-1,3-dioxo-1,3-bis(2,2,2-trichloroethoxy)propan-2-yl]disulfanyl]propanedioate |
| SMILES | O=C(OCC(Cl)(Cl)Cl)C(Cl)(SSC(Cl)(C(=O)OCC(Cl)(Cl)Cl)C(=O)OCC(Cl)(Cl)Cl)C(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H8Cl14O8S2/c15-9(16,17)1-33-5(29)13(27,6(30)34-2-10(18,19)20)37-38-14(28,7(31)35-3-11(21,22)23)8(32)36-4-12(24,25)26/h1-4H2 |
| InChIKey | AZMAJXOWFSKODJ-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.69 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|