C13H27NO3 — CID 3414644
N-(2,2-dimethoxyethyl)-2-ethyl-N-methylhexanamide (PubChem CID 3414644) has the molecular formula C13H27NO3 and a molecular weight of 245.36 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-2-ethyl-N-methylhexanamide.
| Compound Name | N-(2,2-dimethoxyethyl)-2-ethyl-N-methylhexanamide |
|---|---|
| PubChem CID | 3414644 |
| Molecular Formula | C13H27NO3 |
| Molecular Weight | 245.36 g/mol |
| Exact Mass | 245.20 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-2-ethyl-N-methylhexanamide |
| SMILES | CCCCC(CC)C(=O)N(C)CC(OC)OC |
| InChI | InChI=1S/C13H27NO3/c1-6-8-9-11(7-2)13(15)14(3)10-12(16-4)17-5/h11-12H,6-10H2,1-5H3 |
| InChIKey | HTPKLQFLYONRPP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|