C17H38NO7P — CID 175200186
2-ethyl-N,N-dihydroxypentadecanamide;phosphoric acid (PubChem CID 175200186) has the molecular formula C17H38NO7P and a molecular weight of 399.47 g/mol. Its IUPAC name is 2-ethyl-N,N-dihydroxypentadecanamide;phosphoric acid.
| Compound Name | 2-ethyl-N,N-dihydroxypentadecanamide;phosphoric acid |
|---|---|
| PubChem CID | 175200186 |
| Molecular Formula | C17H38NO7P |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | 2-ethyl-N,N-dihydroxypentadecanamide;phosphoric acid |
| SMILES | CCCCCCCCCCCCCC(CC)C(=O)N(O)O.O=P(O)(O)O |
| InChI | InChI=1S/C17H35NO3.H3O4P/c1-3-5-6-7-8-9-10-11-12-13-14-15-16(4-2)17(19)18(20)21;1-5(2,3)4/h16,20-21H,3-15H2,1-2H3;(H3,1,2,3,4) |
| InChIKey | NBKWUYTXBNSYGB-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 138.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|