C14H29NO3 — CID 139887025
2-ethyl-N,N-bis(hydroxymethyl)decanamide (PubChem CID 139887025) has the molecular formula C14H29NO3 and a molecular weight of 259.39 g/mol. Its IUPAC name is 2-ethyl-N,N-bis(hydroxymethyl)decanamide.
| Compound Name | 2-ethyl-N,N-bis(hydroxymethyl)decanamide |
|---|---|
| PubChem CID | 139887025 |
| Molecular Formula | C14H29NO3 |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.21 |
| IUPAC Name | 2-ethyl-N,N-bis(hydroxymethyl)decanamide |
| SMILES | CCCCCCCCC(CC)C(=O)N(CO)CO |
| InChI | InChI=1S/C14H29NO3/c1-3-5-6-7-8-9-10-13(4-2)14(18)15(11-16)12-17/h13,16-17H,3-12H2,1-2H3 |
| InChIKey | GFBBUQTXFMMKID-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|