C23H45NO4 — CID 139887026
(Z)-12-hydroxy-N,N-bis(hydroxymethyl)-2-propyloctadec-9-enamide (PubChem CID 139887026) has the molecular formula C23H45NO4 and a molecular weight of 399.62 g/mol. Its IUPAC name is (Z)-12-hydroxy-N,N-bis(hydroxymethyl)-2-propyloctadec-9-enamide.
| Compound Name | (Z)-12-hydroxy-N,N-bis(hydroxymethyl)-2-propyloctadec-9-enamide |
|---|---|
| PubChem CID | 139887026 |
| Molecular Formula | C23H45NO4 |
| Molecular Weight | 399.62 g/mol |
| Exact Mass | 399.33 |
| IUPAC Name | (Z)-12-hydroxy-N,N-bis(hydroxymethyl)-2-propyloctadec-9-enamide |
| SMILES | CCCCCCC(O)C/C=C\CCCCCCC(CCC)C(=O)N(CO)CO |
| InChI | InChI=1S/C23H45NO4/c1-3-5-6-13-17-22(27)18-14-11-9-7-8-10-12-16-21(15-4-2)23(28)24(19-25)20-26/h11,14,21-22,25-27H,3-10,12-13,15-20H2,1-2H3/b14-11- |
| InChIKey | NYVGTPBJSIKTMR-KAMYIIQDSA-N |
| XLogP | 4.75 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.62 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|