C20H41NO5 — CID 175624547
(2R,3R,4R)-2,3,5-tributoxy-4-methoxy-N,N-dimethylpentanamide (PubChem CID 175624547) has the molecular formula C20H41NO5 and a molecular weight of 375.55 g/mol. Its IUPAC name is (2R,3R,4R)-2,3,5-tributoxy-4-methoxy-N,N-dimethylpentanamide.
| Compound Name | (2R,3R,4R)-2,3,5-tributoxy-4-methoxy-N,N-dimethylpentanamide |
|---|---|
| PubChem CID | 175624547 |
| Molecular Formula | C20H41NO5 |
| Molecular Weight | 375.55 g/mol |
| Exact Mass | 375.30 |
| IUPAC Name | (2R,3R,4R)-2,3,5-tributoxy-4-methoxy-N,N-dimethylpentanamide |
| SMILES | CCCCOC[C@@H](OC)[C@@H](OCCCC)[C@@H](OCCCC)C(=O)N(C)C |
| InChI | InChI=1S/C20H41NO5/c1-7-10-13-24-16-17(23-6)18(25-14-11-8-2)19(20(22)21(4)5)26-15-12-9-3/h17-19H,7-16H2,1-6H3/t17-,18-,19-/m1/s1 |
| InChIKey | FWCXFQHEOFCFAG-GUDVDZBRSA-N |
| XLogP | 3.28 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.55 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|