About methyl (3S)-2-[(1R,2S)-1-bromo-2,3-dibutoxypropoxy]-3-hydroxybutanoate
methyl (3S)-2-[(1R,2S)-1-bromo-2,3-dibutoxypropoxy]-3-hydroxybutanoate (PubChem CID 122533067) has the molecular formula C16H31BrO6
and a molecular weight of 399.32 g/mol. Its IUPAC name is methyl (3S)-2-[(1R,2S)-1-bromo-2,3-dibutoxypropoxy]-3-hydroxybutanoate.
Molecular Properties
| Compound Name | methyl (3S)-2-[(1R,2S)-1-bromo-2,3-dibutoxypropoxy]-3-hydroxybutanoate |
| PubChem CID | 122533067 |
| Molecular Formula | C16H31BrO6 |
| Molecular Weight | 399.32 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | methyl (3S)-2-[(1R,2S)-1-bromo-2,3-dibutoxypropoxy]-3-hydroxybutanoate |
| SMILES | CCCCOC[C@H](OCCCC)[C@@H](Br)OC(C(=O)OC)[C@H](C)O |
| InChI | InChI=1S/C16H31BrO6/c1-5-7-9-21-11-13(22-10-8-6-2)15(17)23-14(12(3)18)16(19)20-4/h12-15,18H,5-11H2,1-4H3/t12-,13-,14?,15-/m0/s1 |
| InChIKey | UZSCKMJHPDNJKA-NZATWWQASA-N |
| XLogP | 2.65 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze methyl (3S)-2-[(1R,2S)-1-bromo-2,3-dibutoxypropoxy]-3-hydroxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3S)-2-[(1R,2S)-1-bromo-2,3-dibutoxypropoxy]-3-hydroxybutanoate?
The IUPAC name of methyl (3S)-2-[(1R,2S)-1-bromo-2,3-dibutoxypropoxy]-3-hydroxybutanoate (CID 122533067) is methyl (3S)-2-[(1R,2S)-1-bromo-2,3-dibutoxypropoxy]-3-hydroxybutanoate.
What is the SMILES notation for methyl (3S)-2-[(1R,2S)-1-bromo-2,3-dibutoxypropoxy]-3-hydroxybutanoate?
The canonical SMILES for methyl (3S)-2-[(1R,2S)-1-bromo-2,3-dibutoxypropoxy]-3-hydroxybutanoate is CCCCOC[C@H](OCCCC)[C@@H](Br)OC(C(=O)OC)[C@H](C)O.
What is the InChIKey of methyl (3S)-2-[(1R,2S)-1-bromo-2,3-dibutoxypropoxy]-3-hydroxybutanoate?
The InChIKey is UZSCKMJHPDNJKA-NZATWWQASA-N. The full InChI is InChI=1S/C16H31BrO6/c1-5-7-9-21-11-13(22-10-8-6-2)15(17)23-14(12(3)18)16(19)20-4/h12-15,18H,5-11H2,1-4H3/t12-,13-,14?,15-/m0/s1.
What are the key properties of methyl (3S)-2-[(1R,2S)-1-bromo-2,3-dibutoxypropoxy]-3-hydroxybutanoate?
methyl (3S)-2-[(1R,2S)-1-bromo-2,3-dibutoxypropoxy]-3-hydroxybutanoate has a molecular weight of 399.32 g/mol, XLogP of 2.65, 14 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3S)-2-[(1R,2S)-1-bromo-2,3-dibutoxypropoxy]-3-hydroxybutanoate is sourced from PubChem (CID 122533067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).