C16H31BrO6 — CID 122533067
methyl (3S)-2-[(1R,2S)-1-bromo-2,3-dibutoxypropoxy]-3-hydroxybutanoate (PubChem CID 122533067) has the molecular formula C16H31BrO6 and a molecular weight of 399.32 g/mol. Its IUPAC name is methyl (3S)-2-[(1R,2S)-1-bromo-2,3-dibutoxypropoxy]-3-hydroxybutanoate.
| Compound Name | methyl (3S)-2-[(1R,2S)-1-bromo-2,3-dibutoxypropoxy]-3-hydroxybutanoate |
|---|---|
| PubChem CID | 122533067 |
| Molecular Formula | C16H31BrO6 |
| Molecular Weight | 399.32 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | methyl (3S)-2-[(1R,2S)-1-bromo-2,3-dibutoxypropoxy]-3-hydroxybutanoate |
| SMILES | CCCCOC[C@H](OCCCC)[C@@H](Br)OC(C(=O)OC)[C@H](C)O |
| InChI | InChI=1S/C16H31BrO6/c1-5-7-9-21-11-13(22-10-8-6-2)15(17)23-14(12(3)18)16(19)20-4/h12-15,18H,5-11H2,1-4H3/t12-,13-,14?,15-/m0/s1 |
| InChIKey | UZSCKMJHPDNJKA-NZATWWQASA-N |
| XLogP | 2.65 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|